C24H29F2N3O3 — CID 142511219
2-[3-(difluoromethoxy)-4-methoxyphenyl]-7-[pentyl(propyl)amino]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 142511219) has the molecular formula C24H29F2N3O3 and a molecular weight of 445.51 g/mol. Its IUPAC name is 2-[3-(difluoromethoxy)-4-methoxyphenyl]-7-[pentyl(propyl)amino]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[3-(difluoromethoxy)-4-methoxyphenyl]-7-[pentyl(propyl)amino]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 142511219 |
| Molecular Formula | C24H29F2N3O3 |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 2-[3-(difluoromethoxy)-4-methoxyphenyl]-7-[pentyl(propyl)amino]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | CCCCCN(CCC)c1ccc2nc(-c3ccc(OC)c(OC(F)F)c3)cc(=O)n2c1 |
| InChI | InChI=1S/C24H29F2N3O3/c1-4-6-7-13-28(12-5-2)18-9-11-22-27-19(15-23(30)29(22)16-18)17-8-10-20(31-3)21(14-17)32-24(25)26/h8-11,14-16,24H,4-7,12-13H2,1-3H3 |
| InChIKey | NUUKKPJFGFENST-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|