C27H37N5 — CID 142511265
(E)-1-[4-cyclobutylidene-7-(4-methylpiperazin-1-yl)pyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethyl-4-methylidenehept-2-en-1-imine (PubChem CID 142511265) has the molecular formula C27H37N5 and a molecular weight of 431.63 g/mol. Its IUPAC name is (E)-1-[4-cyclobutylidene-7-(4-methylpiperazin-1-yl)pyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethyl-4-methylidenehept-2-en-1-imine.
| Compound Name | (E)-1-[4-cyclobutylidene-7-(4-methylpiperazin-1-yl)pyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethyl-4-methylidenehept-2-en-1-imine |
|---|---|
| PubChem CID | 142511265 |
| Molecular Formula | C27H37N5 |
| Molecular Weight | 431.63 g/mol |
| Exact Mass | 431.30 |
| IUPAC Name | (E)-1-[4-cyclobutylidene-7-(4-methylpiperazin-1-yl)pyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethyl-4-methylidenehept-2-en-1-imine |
| SMILES | C=C(CCC)/C(C)=C/C(=N\C)C1=CC(=C2CCC2)N2C=C(N3CCN(C)CC3)C=CC2=N1 |
| InChI | InChI=1S/C27H37N5/c1-6-8-20(2)21(3)17-24(28-4)25-18-26(22-9-7-10-22)32-19-23(11-12-27(32)29-25)31-15-13-30(5)14-16-31/h11-12,17-19H,2,6-10,13-16H2,1,3-5H3/b21-17+,28-24+ |
| InChIKey | GPGOZJKACUAKGT-MRGNUWOCSA-N |
| XLogP | 5.05 |
| TPSA | 34.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.63 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|