C22H27FN4O — CID 142511306
7-[(3S)-3,5-dimethylpiperazin-1-yl]-2-[(2E,4E)-5-fluoro-6-methylhepta-2,4,6-trien-3-yl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 142511306) has the molecular formula C22H27FN4O and a molecular weight of 382.48 g/mol. Its IUPAC name is 7-[(3S)-3,5-dimethylpiperazin-1-yl]-2-[(2E,4E)-5-fluoro-6-methylhepta-2,4,6-trien-3-yl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 7-[(3S)-3,5-dimethylpiperazin-1-yl]-2-[(2E,4E)-5-fluoro-6-methylhepta-2,4,6-trien-3-yl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 142511306 |
| Molecular Formula | C22H27FN4O |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | 7-[(3S)-3,5-dimethylpiperazin-1-yl]-2-[(2E,4E)-5-fluoro-6-methylhepta-2,4,6-trien-3-yl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | C=C(C)/C(F)=C\C(=C/C)c1cc(=O)n2cc(N3CC(C)N[C@@H](C)C3)ccc2n1 |
| InChI | InChI=1S/C22H27FN4O/c1-6-17(9-19(23)14(2)3)20-10-22(28)27-13-18(7-8-21(27)25-20)26-11-15(4)24-16(5)12-26/h6-10,13,15-16,24H,2,11-12H2,1,3-5H3/b17-6+,19-9+/t15-,16?/m0/s1 |
| InChIKey | IEQDTDCALRGYIF-WQJSYGAXSA-N |
| XLogP | 3.71 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|