C24H31N3O — CID 142511316
2-[(4Z)-5-ethyl-6-methylhepta-2,4,6-trien-3-yl]-7-(1-methylpiperidin-4-yl)pyrido[1,2-a]pyrimidin-4-one (PubChem CID 142511316) has the molecular formula C24H31N3O and a molecular weight of 377.53 g/mol. Its IUPAC name is 2-[(4Z)-5-ethyl-6-methylhepta-2,4,6-trien-3-yl]-7-(1-methylpiperidin-4-yl)pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[(4Z)-5-ethyl-6-methylhepta-2,4,6-trien-3-yl]-7-(1-methylpiperidin-4-yl)pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 142511316 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 2-[(4Z)-5-ethyl-6-methylhepta-2,4,6-trien-3-yl]-7-(1-methylpiperidin-4-yl)pyrido[1,2-a]pyrimidin-4-one |
| SMILES | C=C(C)/C(=C\C(=CC)c1cc(=O)n2cc(C3CCN(C)CC3)ccc2n1)CC |
| InChI | InChI=1S/C24H31N3O/c1-6-18(17(3)4)14-19(7-2)22-15-24(28)27-16-21(8-9-23(27)25-22)20-10-12-26(5)13-11-20/h7-9,14-16,20H,3,6,10-13H2,1-2,4-5H3/b18-14-,19-7? |
| InChIKey | BVJINGNHYMFAOG-ZWVCIOSBSA-N |
| XLogP | 4.82 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|