About ethane;2-(3-ethylphenyl)-7-[4-methylhexyl(propyl)amino]pyrido[1,2-a]pyrimidin-4-one
ethane;2-(3-ethylphenyl)-7-[4-methylhexyl(propyl)amino]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 142511374) has the molecular formula C28H41N3O
and a molecular weight of 435.66 g/mol. Its IUPAC name is ethane;2-(3-ethylphenyl)-7-[4-methylhexyl(propyl)amino]pyrido[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | ethane;2-(3-ethylphenyl)-7-[4-methylhexyl(propyl)amino]pyrido[1,2-a]pyrimidin-4-one |
| PubChem CID | 142511374 |
| Molecular Formula | C28H41N3O |
| Molecular Weight | 435.66 g/mol |
| Exact Mass | 435.32 |
| IUPAC Name | ethane;2-(3-ethylphenyl)-7-[4-methylhexyl(propyl)amino]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | CC.CCCN(CCCC(C)CC)c1ccc2nc(-c3cccc(CC)c3)cc(=O)n2c1 |
| InChI | InChI=1S/C26H35N3O.C2H6/c1-5-15-28(16-9-10-20(4)6-2)23-13-14-25-27-24(18-26(30)29(25)19-23)22-12-8-11-21(7-3)17-22;1-2/h8,11-14,17-20H,5-7,9-10,15-16H2,1-4H3;1-2H3 |
| InChIKey | UTTBNYPVTFVQBM-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.66 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;2-(3-ethylphenyl)-7-[4-methylhexyl(propyl)amino]pyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(3-ethylphenyl)-7-[4-methylhexyl(propyl)amino]pyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of ethane;2-(3-ethylphenyl)-7-[4-methylhexyl(propyl)amino]pyrido[1,2-a]pyrimidin-4-one (CID 142511374) is ethane;2-(3-ethylphenyl)-7-[4-methylhexyl(propyl)amino]pyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for ethane;2-(3-ethylphenyl)-7-[4-methylhexyl(propyl)amino]pyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for ethane;2-(3-ethylphenyl)-7-[4-methylhexyl(propyl)amino]pyrido[1,2-a]pyrimidin-4-one is CC.CCCN(CCCC(C)CC)c1ccc2nc(-c3cccc(CC)c3)cc(=O)n2c1.
What is the InChIKey of ethane;2-(3-ethylphenyl)-7-[4-methylhexyl(propyl)amino]pyrido[1,2-a]pyrimidin-4-one?
The InChIKey is UTTBNYPVTFVQBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H35N3O.C2H6/c1-5-15-28(16-9-10-20(4)6-2)23-13-14-25-27-24(18-26(30)29(25)19-23)22-12-8-11-21(7-3)17-22;1-2/h8,11-14,17-20H,5-7,9-10,15-16H2,1-4H3;1-2H3.
What are the key properties of ethane;2-(3-ethylphenyl)-7-[4-methylhexyl(propyl)amino]pyrido[1,2-a]pyrimidin-4-one?
ethane;2-(3-ethylphenyl)-7-[4-methylhexyl(propyl)amino]pyrido[1,2-a]pyrimidin-4-one has a molecular weight of 435.66 g/mol, XLogP of 6.99, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(3-ethylphenyl)-7-[4-methylhexyl(propyl)amino]pyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 142511374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).