C26H36N6O — CID 142511512
2-[(2Z)-4-[[(Z)-2,3-dimethylpent-1-enyl]amino]penta-2,4-dienimidoyl]-7-[(3S,5R)-3,5-dimethylpiperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 142511512) has the molecular formula C26H36N6O and a molecular weight of 448.62 g/mol. Its IUPAC name is 2-[(2Z)-4-[[(Z)-2,3-dimethylpent-1-enyl]amino]penta-2,4-dienimidoyl]-7-[(3S,5R)-3,5-dimethylpiperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[(2Z)-4-[[(Z)-2,3-dimethylpent-1-enyl]amino]penta-2,4-dienimidoyl]-7-[(3S,5R)-3,5-dimethylpiperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 142511512 |
| Molecular Formula | C26H36N6O |
| Molecular Weight | 448.62 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | 2-[(2Z)-4-[[(Z)-2,3-dimethylpent-1-enyl]amino]penta-2,4-dienimidoyl]-7-[(3S,5R)-3,5-dimethylpiperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | [H]/N=C(/C=C\C(=C)N/C=C(/C)C(C)CC)c1cc(=O)n2cc(N3C[C@@H](C)N[C@@H](C)C3)ccc2n1 |
| InChI | InChI=1S/C26H36N6O/c1-7-17(2)18(3)13-28-19(4)8-10-23(27)24-12-26(33)32-16-22(9-11-25(32)30-24)31-14-20(5)29-21(6)15-31/h8-13,16-17,20-21,27-29H,4,7,14-15H2,1-3,5-6H3/b10-8-,18-13-,27-23-/t17?,20-,21+ |
| InChIKey | VNJLLAPRGOPEAY-UVBJBINKSA-N |
| XLogP | 3.86 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.62 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|