About 6-(4-aminobenzoyl)-8-fluoro-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxylic acid
6-(4-aminobenzoyl)-8-fluoro-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxylic acid (PubChem CID 142512254) has the molecular formula C20H15FN2O3S
and a molecular weight of 382.42 g/mol. Its IUPAC name is 6-(4-aminobenzoyl)-8-fluoro-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-(4-aminobenzoyl)-8-fluoro-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxylic acid |
| PubChem CID | 142512254 |
| Molecular Formula | C20H15FN2O3S |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 6-(4-aminobenzoyl)-8-fluoro-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxylic acid |
| SMILES | Nc1ccc(C(=O)N2CCc3cc(C(=O)O)sc3-c3ccc(F)cc32)cc1 |
| InChI | InChI=1S/C20H15FN2O3S/c21-13-3-6-15-16(10-13)23(19(24)11-1-4-14(22)5-2-11)8-7-12-9-17(20(25)26)27-18(12)15/h1-6,9-10H,7-8,22H2,(H,25,26) |
| InChIKey | PDQCHKMZUHWZAZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-aminobenzoyl)-8-fluoro-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-aminobenzoyl)-8-fluoro-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxylic acid?
The IUPAC name of 6-(4-aminobenzoyl)-8-fluoro-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxylic acid (CID 142512254) is 6-(4-aminobenzoyl)-8-fluoro-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxylic acid.
What is the SMILES notation for 6-(4-aminobenzoyl)-8-fluoro-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxylic acid?
The canonical SMILES for 6-(4-aminobenzoyl)-8-fluoro-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxylic acid is Nc1ccc(C(=O)N2CCc3cc(C(=O)O)sc3-c3ccc(F)cc32)cc1.
What is the InChIKey of 6-(4-aminobenzoyl)-8-fluoro-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxylic acid?
The InChIKey is PDQCHKMZUHWZAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15FN2O3S/c21-13-3-6-15-16(10-13)23(19(24)11-1-4-14(22)5-2-11)8-7-12-9-17(20(25)26)27-18(12)15/h1-6,9-10H,7-8,22H2,(H,25,26).
What are the key properties of 6-(4-aminobenzoyl)-8-fluoro-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxylic acid?
6-(4-aminobenzoyl)-8-fluoro-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxylic acid has a molecular weight of 382.42 g/mol, XLogP of 4.04, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-aminobenzoyl)-8-fluoro-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxylic acid is sourced from PubChem (CID 142512254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).