About ethane;4,7,7-trimethyl-1,4-thiazepane
ethane;4,7,7-trimethyl-1,4-thiazepane (PubChem CID 142512395) has the molecular formula C10H23NS
and a molecular weight of 189.37 g/mol. Its IUPAC name is ethane;4,7,7-trimethyl-1,4-thiazepane.
Molecular Properties
| Compound Name | ethane;4,7,7-trimethyl-1,4-thiazepane |
| PubChem CID | 142512395 |
| Molecular Formula | C10H23NS |
| Molecular Weight | 189.37 g/mol |
| Exact Mass | 189.16 |
| IUPAC Name | ethane;4,7,7-trimethyl-1,4-thiazepane |
| SMILES | CC.CN1CCSC(C)(C)CC1 |
| InChI | InChI=1S/C8H17NS.C2H6/c1-8(2)4-5-9(3)6-7-10-8;1-2/h4-7H2,1-3H3;1-2H3 |
| InChIKey | UPYXLIAZNIWZQN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4,7,7-trimethyl-1,4-thiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4,7,7-trimethyl-1,4-thiazepane?
The IUPAC name of ethane;4,7,7-trimethyl-1,4-thiazepane (CID 142512395) is ethane;4,7,7-trimethyl-1,4-thiazepane.
What is the SMILES notation for ethane;4,7,7-trimethyl-1,4-thiazepane?
The canonical SMILES for ethane;4,7,7-trimethyl-1,4-thiazepane is CC.CN1CCSC(C)(C)CC1.
What is the InChIKey of ethane;4,7,7-trimethyl-1,4-thiazepane?
The InChIKey is UPYXLIAZNIWZQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NS.C2H6/c1-8(2)4-5-9(3)6-7-10-8;1-2/h4-7H2,1-3H3;1-2H3.
What are the key properties of ethane;4,7,7-trimethyl-1,4-thiazepane?
ethane;4,7,7-trimethyl-1,4-thiazepane has a molecular weight of 189.37 g/mol, XLogP of 2.86, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4,7,7-trimethyl-1,4-thiazepane is sourced from PubChem (CID 142512395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).