C16H21F3O5 — CID 142512665
2,2,4,4-tetramethyl-6-[2-methyl-4-(trifluoromethoxy)butanoyl]cyclohexane-1,3,5-trione (PubChem CID 142512665) has the molecular formula C16H21F3O5 and a molecular weight of 350.33 g/mol. Its IUPAC name is 2,2,4,4-tetramethyl-6-[2-methyl-4-(trifluoromethoxy)butanoyl]cyclohexane-1,3,5-trione.
| Compound Name | 2,2,4,4-tetramethyl-6-[2-methyl-4-(trifluoromethoxy)butanoyl]cyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 142512665 |
| Molecular Formula | C16H21F3O5 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 2,2,4,4-tetramethyl-6-[2-methyl-4-(trifluoromethoxy)butanoyl]cyclohexane-1,3,5-trione |
| SMILES | CC(CCOC(F)(F)F)C(=O)C1C(=O)C(C)(C)C(=O)C(C)(C)C1=O |
| InChI | InChI=1S/C16H21F3O5/c1-8(6-7-24-16(17,18)19)10(20)9-11(21)14(2,3)13(23)15(4,5)12(9)22/h8-9H,6-7H2,1-5H3 |
| InChIKey | CSUVRTLNDODYTG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|