C14H18Br2O4 — CID 142512673
6-(3,3-dibromo-2-methylpropanoyl)-2,2,4,4-tetramethylcyclohexane-1,3,5-trione (PubChem CID 142512673) has the molecular formula C14H18Br2O4 and a molecular weight of 410.10 g/mol. Its IUPAC name is 6-(3,3-dibromo-2-methylpropanoyl)-2,2,4,4-tetramethylcyclohexane-1,3,5-trione.
| Compound Name | 6-(3,3-dibromo-2-methylpropanoyl)-2,2,4,4-tetramethylcyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 142512673 |
| Molecular Formula | C14H18Br2O4 |
| Molecular Weight | 410.10 g/mol |
| Exact Mass | 407.96 |
| IUPAC Name | 6-(3,3-dibromo-2-methylpropanoyl)-2,2,4,4-tetramethylcyclohexane-1,3,5-trione |
| SMILES | CC(C(=O)C1C(=O)C(C)(C)C(=O)C(C)(C)C1=O)C(Br)Br |
| InChI | InChI=1S/C14H18Br2O4/c1-6(11(15)16)8(17)7-9(18)13(2,3)12(20)14(4,5)10(7)19/h6-7,11H,1-5H3 |
| InChIKey | VKKSUIZZIKUVPK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.10 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|