C19H17N2OS+ — CID 142512857
N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]quinolin-1-ium-2-carbothioamide (PubChem CID 142512857) has the molecular formula C19H17N2OS+ and a molecular weight of 321.43 g/mol. Its IUPAC name is N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]quinolin-1-ium-2-carbothioamide.
| Compound Name | N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]quinolin-1-ium-2-carbothioamide |
|---|---|
| PubChem CID | 142512857 |
| Molecular Formula | C19H17N2OS+ |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]quinolin-1-ium-2-carbothioamide |
| SMILES | O[C@@H]1Cc2ccccc2[C@@H]1NC(=S)c1ccc2ccccc2[nH+]1 |
| InChI | InChI=1S/C19H16N2OS/c22-17-11-13-6-1-3-7-14(13)18(17)21-19(23)16-10-9-12-5-2-4-8-15(12)20-16/h1-10,17-18,22H,11H2,(H,21,23)/p+1/t17-,18+/m1/s1 |
| InChIKey | FPKNHJOCCRJXPE-MSOLQXFVSA-O |
| XLogP | 2.58 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|