C12H22N2S3 — CID 14251310
5-(3,6,6-trimethylheptylsulfanyl)-3H-1,3,4-thiadiazole-2-thione (PubChem CID 14251310) has the molecular formula C12H22N2S3 and a molecular weight of 290.52 g/mol. Its IUPAC name is 5-(3,6,6-trimethylheptylsulfanyl)-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-(3,6,6-trimethylheptylsulfanyl)-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 14251310 |
| Molecular Formula | C12H22N2S3 |
| Molecular Weight | 290.52 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 5-(3,6,6-trimethylheptylsulfanyl)-3H-1,3,4-thiadiazole-2-thione |
| SMILES | CC(CCSc1n[nH]c(=S)s1)CCC(C)(C)C |
| InChI | InChI=1S/C12H22N2S3/c1-9(5-7-12(2,3)4)6-8-16-11-14-13-10(15)17-11/h9H,5-8H2,1-4H3,(H,13,15) |
| InChIKey | CPQCTGBNDLACDO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.52 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|