About ethane;1-[2-methyl-4-(2-methyl-4-prop-2-ynoxybutan-2-yl)oxybutan-2-yl]pyrrole-2,5-dione
ethane;1-[2-methyl-4-(2-methyl-4-prop-2-ynoxybutan-2-yl)oxybutan-2-yl]pyrrole-2,5-dione (PubChem CID 142513543) has the molecular formula C21H37NO4
and a molecular weight of 367.53 g/mol. Its IUPAC name is ethane;1-[2-methyl-4-(2-methyl-4-prop-2-ynoxybutan-2-yl)oxybutan-2-yl]pyrrole-2,5-dione.
Molecular Properties
| Compound Name | ethane;1-[2-methyl-4-(2-methyl-4-prop-2-ynoxybutan-2-yl)oxybutan-2-yl]pyrrole-2,5-dione |
| PubChem CID | 142513543 |
| Molecular Formula | C21H37NO4 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.27 |
| IUPAC Name | ethane;1-[2-methyl-4-(2-methyl-4-prop-2-ynoxybutan-2-yl)oxybutan-2-yl]pyrrole-2,5-dione |
| SMILES | C#CCOCCC(C)(C)OCCC(C)(C)N1C(=O)C=CC1=O.CC.CC |
| InChI | InChI=1S/C17H25NO4.2C2H6/c1-6-11-21-12-10-17(4,5)22-13-9-16(2,3)18-14(19)7-8-15(18)20;2*1-2/h1,7-8H,9-13H2,2-5H3;2*1-2H3 |
| InChIKey | ZARAGZHORXCZMM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-[2-methyl-4-(2-methyl-4-prop-2-ynoxybutan-2-yl)oxybutan-2-yl]pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-[2-methyl-4-(2-methyl-4-prop-2-ynoxybutan-2-yl)oxybutan-2-yl]pyrrole-2,5-dione?
The IUPAC name of ethane;1-[2-methyl-4-(2-methyl-4-prop-2-ynoxybutan-2-yl)oxybutan-2-yl]pyrrole-2,5-dione (CID 142513543) is ethane;1-[2-methyl-4-(2-methyl-4-prop-2-ynoxybutan-2-yl)oxybutan-2-yl]pyrrole-2,5-dione.
What is the SMILES notation for ethane;1-[2-methyl-4-(2-methyl-4-prop-2-ynoxybutan-2-yl)oxybutan-2-yl]pyrrole-2,5-dione?
The canonical SMILES for ethane;1-[2-methyl-4-(2-methyl-4-prop-2-ynoxybutan-2-yl)oxybutan-2-yl]pyrrole-2,5-dione is C#CCOCCC(C)(C)OCCC(C)(C)N1C(=O)C=CC1=O.CC.CC.
What is the InChIKey of ethane;1-[2-methyl-4-(2-methyl-4-prop-2-ynoxybutan-2-yl)oxybutan-2-yl]pyrrole-2,5-dione?
The InChIKey is ZARAGZHORXCZMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO4.2C2H6/c1-6-11-21-12-10-17(4,5)22-13-9-16(2,3)18-14(19)7-8-15(18)20;2*1-2/h1,7-8H,9-13H2,2-5H3;2*1-2H3.
What are the key properties of ethane;1-[2-methyl-4-(2-methyl-4-prop-2-ynoxybutan-2-yl)oxybutan-2-yl]pyrrole-2,5-dione?
ethane;1-[2-methyl-4-(2-methyl-4-prop-2-ynoxybutan-2-yl)oxybutan-2-yl]pyrrole-2,5-dione has a molecular weight of 367.53 g/mol, XLogP of 3.97, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-[2-methyl-4-(2-methyl-4-prop-2-ynoxybutan-2-yl)oxybutan-2-yl]pyrrole-2,5-dione is sourced from PubChem (CID 142513543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).