C14H18N2O3 — CID 142513714
N-[(1-formylazetidin-3-yl)methyl]-2-(4-methylphenoxy)acetamide (PubChem CID 142513714) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is N-[(1-formylazetidin-3-yl)methyl]-2-(4-methylphenoxy)acetamide.
| Compound Name | N-[(1-formylazetidin-3-yl)methyl]-2-(4-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 142513714 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-[(1-formylazetidin-3-yl)methyl]-2-(4-methylphenoxy)acetamide |
| SMILES | Cc1ccc(OCC(=O)NCC2CN(C=O)C2)cc1 |
| InChI | InChI=1S/C14H18N2O3/c1-11-2-4-13(5-3-11)19-9-14(18)15-6-12-7-16(8-12)10-17/h2-5,10,12H,6-9H2,1H3,(H,15,18) |
| InChIKey | WHCPXENGCSLTBQ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|