C25H47NO2S — CID 142513729
ethane;(5Z,8Z,11Z,14Z)-N-(2-hydroxyethyl)-19-sulfanylnonadeca-5,8,11,14-tetraenamide (PubChem CID 142513729) has the molecular formula C25H47NO2S and a molecular weight of 425.72 g/mol. Its IUPAC name is ethane;(5Z,8Z,11Z,14Z)-N-(2-hydroxyethyl)-19-sulfanylnonadeca-5,8,11,14-tetraenamide.
| Compound Name | ethane;(5Z,8Z,11Z,14Z)-N-(2-hydroxyethyl)-19-sulfanylnonadeca-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 142513729 |
| Molecular Formula | C25H47NO2S |
| Molecular Weight | 425.72 g/mol |
| Exact Mass | 425.33 |
| IUPAC Name | ethane;(5Z,8Z,11Z,14Z)-N-(2-hydroxyethyl)-19-sulfanylnonadeca-5,8,11,14-tetraenamide |
| SMILES | CC.CC.O=C(CCC/C=C\C/C=C\C/C=C\C/C=C\CCCCS)NCCO |
| InChI | InChI=1S/C21H35NO2S.2C2H6/c23-19-18-22-21(24)17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-20-25;2*1-2/h2-5,8-11,23,25H,1,6-7,12-20H2,(H,22,24);2*1-2H3/b4-2-,5-3-,10-8-,11-9-;; |
| InChIKey | GUTYZICVQRYFNN-ZZEYNTFJSA-N |
| XLogP | 6.81 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.72 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|