C14H17BN2Na2O6 — CID 142513902
disodium;9-(1-ethanimidoylazetidin-3-yl)oxy-3,3-dihydroxy-2-oxa-3-boranuidabicyclo[4.4.0]deca-1(6),7,9-triene-10-carboxylate (PubChem CID 142513902) has the molecular formula C14H17BN2Na2O6 and a molecular weight of 366.09 g/mol. Its IUPAC name is disodium;9-(1-ethanimidoylazetidin-3-yl)oxy-3,3-dihydroxy-2-oxa-3-boranuidabicyclo[4.4.0]deca-1(6),7,9-triene-10-carboxylate.
| Compound Name | disodium;9-(1-ethanimidoylazetidin-3-yl)oxy-3,3-dihydroxy-2-oxa-3-boranuidabicyclo[4.4.0]deca-1(6),7,9-triene-10-carboxylate |
|---|---|
| PubChem CID | 142513902 |
| Molecular Formula | C14H17BN2Na2O6 |
| Molecular Weight | 366.09 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | disodium;9-(1-ethanimidoylazetidin-3-yl)oxy-3,3-dihydroxy-2-oxa-3-boranuidabicyclo[4.4.0]deca-1(6),7,9-triene-10-carboxylate |
| SMILES | [H]/N=C(\C)N1CC(Oc2ccc3c(c2C(=O)[O-])O[B-](O)(O)CC3)C1.[Na+].[Na+] |
| InChI | InChI=1S/C14H18BN2O6.2Na/c1-8(16)17-6-10(7-17)22-11-3-2-9-4-5-15(20,21)23-13(9)12(11)14(18)19;;/h2-3,10,16,20-21H,4-7H2,1H3,(H,18,19);;/q-1;2*+1/p-1/b16-8+;; |
| InChIKey | VDLUHRCCKJLPRN-RFZNCAAWSA-M |
| XLogP | -7.02 |
| TPSA | 126.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.09 |
| LogP ≤ 5 | -7.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|