C16H23BN2O7S — CID 142514095
3-[(2R)-2-[2-[(3S)-3-aminopyrrolidin-1-yl]-2-oxoethyl]sulfanyl-2-boronoethyl]-2-hydroxy-6-methoxybenzoic acid (PubChem CID 142514095) has the molecular formula C16H23BN2O7S and a molecular weight of 398.25 g/mol. Its IUPAC name is 3-[(2R)-2-[2-[(3S)-3-aminopyrrolidin-1-yl]-2-oxoethyl]sulfanyl-2-boronoethyl]-2-hydroxy-6-methoxybenzoic acid.
| Compound Name | 3-[(2R)-2-[2-[(3S)-3-aminopyrrolidin-1-yl]-2-oxoethyl]sulfanyl-2-boronoethyl]-2-hydroxy-6-methoxybenzoic acid |
|---|---|
| PubChem CID | 142514095 |
| Molecular Formula | C16H23BN2O7S |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 3-[(2R)-2-[2-[(3S)-3-aminopyrrolidin-1-yl]-2-oxoethyl]sulfanyl-2-boronoethyl]-2-hydroxy-6-methoxybenzoic acid |
| SMILES | COc1ccc(C[C@H](SCC(=O)N2CC[C@H](N)C2)B(O)O)c(O)c1C(=O)O |
| InChI | InChI=1S/C16H23BN2O7S/c1-26-11-3-2-9(15(21)14(11)16(22)23)6-12(17(24)25)27-8-13(20)19-5-4-10(18)7-19/h2-3,10,12,21,24-25H,4-8,18H2,1H3,(H,22,23)/t10-,12-/m0/s1 |
| InChIKey | KAXOVVHGPAYVRF-JQWIXIFHSA-N |
| XLogP | -0.69 |
| TPSA | 153.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|