C8H14N4 — CID 142514424
(1E,3E)-2-N-cyclopropyl-3-methanimidoylbuta-1,3-diene-1,2,4-triamine (PubChem CID 142514424) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is (1E,3E)-2-N-cyclopropyl-3-methanimidoylbuta-1,3-diene-1,2,4-triamine.
| Compound Name | (1E,3E)-2-N-cyclopropyl-3-methanimidoylbuta-1,3-diene-1,2,4-triamine |
|---|---|
| PubChem CID | 142514424 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | (1E,3E)-2-N-cyclopropyl-3-methanimidoylbuta-1,3-diene-1,2,4-triamine |
| SMILES | [H]/N=C/C(=C/N)/C(=C\N)NC1CC1 |
| InChI | InChI=1S/C8H14N4/c9-3-6(4-10)8(5-11)12-7-1-2-7/h3-5,7,9,12H,1-2,10-11H2/b6-4-,8-5+,9-3+ |
| InChIKey | IMSYXDCWGNGQDE-XRVPIJFVSA-N |
| XLogP | 0.03 |
| TPSA | 87.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|