About 7-ethenylthieno[3,2-c]pyridine
7-ethenylthieno[3,2-c]pyridine (PubChem CID 142514449) has the molecular formula C9H7NS
and a molecular weight of 161.23 g/mol. Its IUPAC name is 7-ethenylthieno[3,2-c]pyridine.
Molecular Properties
| Compound Name | 7-ethenylthieno[3,2-c]pyridine |
| PubChem CID | 142514449 |
| Molecular Formula | C9H7NS |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.03 |
| IUPAC Name | 7-ethenylthieno[3,2-c]pyridine |
| SMILES | C=Cc1cncc2ccsc12 |
| InChI | InChI=1S/C9H7NS/c1-2-7-5-10-6-8-3-4-11-9(7)8/h2-6H,1H2 |
| InChIKey | AGLLLHYTGKMXPA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-ethenylthieno[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethenylthieno[3,2-c]pyridine?
The IUPAC name of 7-ethenylthieno[3,2-c]pyridine (CID 142514449) is 7-ethenylthieno[3,2-c]pyridine.
What is the SMILES notation for 7-ethenylthieno[3,2-c]pyridine?
The canonical SMILES for 7-ethenylthieno[3,2-c]pyridine is C=Cc1cncc2ccsc12.
What is the InChIKey of 7-ethenylthieno[3,2-c]pyridine?
The InChIKey is AGLLLHYTGKMXPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NS/c1-2-7-5-10-6-8-3-4-11-9(7)8/h2-6H,1H2.
What are the key properties of 7-ethenylthieno[3,2-c]pyridine?
7-ethenylthieno[3,2-c]pyridine has a molecular weight of 161.23 g/mol, XLogP of 2.94, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethenylthieno[3,2-c]pyridine is sourced from PubChem (CID 142514449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).