About CID 142514487
CID 142514487 (PubChem CID 142514487) has the molecular formula C7H5N4
and a molecular weight of 145.14 g/mol.
Molecular Properties
| Compound Name | CID 142514487 |
| PubChem CID | 142514487 |
| Molecular Formula | C7H5N4 |
| Molecular Weight | 145.14 g/mol |
| Exact Mass | 145.05 |
| IUPAC Name | — |
| SMILES | C=Cc1ncc2[nH]n[c]c2n1 |
| InChI | InChI=1S/C7H5N4/c1-2-7-8-3-6-5(10-7)4-9-11-6/h2-3H,1H2,(H,9,11) |
| InChIKey | OIVUTCXHXHFRHQ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.14 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 142514487 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 142514487?
The IUPAC name of CID 142514487 (CID 142514487) is not available.
What is the SMILES notation for CID 142514487?
The canonical SMILES for CID 142514487 is C=Cc1ncc2[nH]n[c]c2n1.
What is the InChIKey of CID 142514487?
The InChIKey is OIVUTCXHXHFRHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N4/c1-2-7-8-3-6-5(10-7)4-9-11-6/h2-3H,1H2,(H,9,11).
What are the key properties of CID 142514487?
CID 142514487 has a molecular weight of 145.14 g/mol, XLogP of 0.80, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 142514487 is sourced from PubChem (CID 142514487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).