C17H30O5S — CID 142514510
(1R,4S,9R)-11,11-ditert-butyl-4-methyl-2,6,10,12-tetraoxa-11λ4-thiatricyclo[7.4.0.03,7]tridecan-5-one (PubChem CID 142514510) has the molecular formula C17H30O5S and a molecular weight of 346.49 g/mol. Its IUPAC name is (1R,4S,9R)-11,11-ditert-butyl-4-methyl-2,6,10,12-tetraoxa-11λ4-thiatricyclo[7.4.0.03,7]tridecan-5-one.
| Compound Name | (1R,4S,9R)-11,11-ditert-butyl-4-methyl-2,6,10,12-tetraoxa-11λ4-thiatricyclo[7.4.0.03,7]tridecan-5-one |
|---|---|
| PubChem CID | 142514510 |
| Molecular Formula | C17H30O5S |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (1R,4S,9R)-11,11-ditert-butyl-4-methyl-2,6,10,12-tetraoxa-11λ4-thiatricyclo[7.4.0.03,7]tridecan-5-one |
| SMILES | C[C@@H]1C(=O)OC2C[C@H]3OS(C(C)(C)C)(C(C)(C)C)OC[C@H]3OC21 |
| InChI | InChI=1S/C17H30O5S/c1-10-14-12(21-15(10)18)8-11-13(20-14)9-19-23(22-11,16(2,3)4)17(5,6)7/h10-14H,8-9H2,1-7H3/t10-,11+,12?,13+,14?/m0/s1 |
| InChIKey | MQAKOJGXZFIHSW-GDYUJFBMSA-N |
| XLogP | 3.35 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |