C31H32F2N6O2 — CID 142514983
cyclopropyl-(7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl)methanone;7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole-2-carbaldehyde;methylcyclopropane (PubChem CID 142514983) has the molecular formula C31H32F2N6O2 and a molecular weight of 558.63 g/mol. Its IUPAC name is cyclopropyl-(7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl)methanone;7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole-2-carbaldehyde;methylcyclopropane.
| Compound Name | cyclopropyl-(7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl)methanone;7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole-2-carbaldehyde;methylcyclopropane |
|---|---|
| PubChem CID | 142514983 |
| Molecular Formula | C31H32F2N6O2 |
| Molecular Weight | 558.63 g/mol |
| Exact Mass | 558.26 |
| IUPAC Name | cyclopropyl-(7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl)methanone;7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole-2-carbaldehyde;methylcyclopropane |
| SMILES | CC1CC1.O=C(c1nc2n(n1)C(c1ccccc1)CC2F)C1CC1.O=Cc1nc2n(n1)C(c1ccccc1)CC2F |
| InChI | InChI=1S/C15H14FN3O.C12H10FN3O.C4H8/c16-11-8-12(9-4-2-1-3-5-9)19-15(11)17-14(18-19)13(20)10-6-7-10;13-9-6-10(8-4-2-1-3-5-8)16-12(9)14-11(7-17)15-16;1-4-2-3-4/h1-5,10-12H,6-8H2;1-5,7,9-10H,6H2;4H,2-3H2,1H3 |
| InChIKey | QTUGTNOUTGTLFN-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 95.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.63 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|