C28H26N2 — CID 142515914
N'-benzyl-4-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]phenyl]-N-methylidenebenzenecarboximidamide (PubChem CID 142515914) has the molecular formula C28H26N2 and a molecular weight of 390.53 g/mol. Its IUPAC name is N'-benzyl-4-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]phenyl]-N-methylidenebenzenecarboximidamide.
| Compound Name | N'-benzyl-4-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]phenyl]-N-methylidenebenzenecarboximidamide |
|---|---|
| PubChem CID | 142515914 |
| Molecular Formula | C28H26N2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | N'-benzyl-4-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]phenyl]-N-methylidenebenzenecarboximidamide |
| SMILES | C=C/C(=C\C=C/C)c1ccc(-c2ccc(/C(N=C)=N/Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H26N2/c1-4-6-12-23(5-2)24-13-15-25(16-14-24)26-17-19-27(20-18-26)28(29-3)30-21-22-10-8-7-9-11-22/h4-20H,2-3,21H2,1H3/b6-4-,23-12+,30-28- |
| InChIKey | DASOFPRLSOSTJE-YDZOWVSMSA-N |
| XLogP | 7.15 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|