C14H18FNS — CID 142516310
4-[(2E,4Z,6Z)-6-fluoronona-2,4,6-trien-3-yl]-2,5-dimethyl-1,3-thiazole (PubChem CID 142516310) has the molecular formula C14H18FNS and a molecular weight of 251.37 g/mol. Its IUPAC name is 4-[(2E,4Z,6Z)-6-fluoronona-2,4,6-trien-3-yl]-2,5-dimethyl-1,3-thiazole.
| Compound Name | 4-[(2E,4Z,6Z)-6-fluoronona-2,4,6-trien-3-yl]-2,5-dimethyl-1,3-thiazole |
|---|---|
| PubChem CID | 142516310 |
| Molecular Formula | C14H18FNS |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 4-[(2E,4Z,6Z)-6-fluoronona-2,4,6-trien-3-yl]-2,5-dimethyl-1,3-thiazole |
| SMILES | C/C=C(\C=C/C(F)=C/CC)c1nc(C)sc1C |
| InChI | InChI=1S/C14H18FNS/c1-5-7-13(15)9-8-12(6-2)14-10(3)17-11(4)16-14/h6-9H,5H2,1-4H3/b9-8-,12-6+,13-7- |
| InChIKey | ZHJWRCLNIDGMKG-DGARHEKDSA-N |
| XLogP | 4.98 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|