About ethane;N-ethenyl-N-methylpropanimidamide;propane
ethane;N-ethenyl-N-methylpropanimidamide;propane (PubChem CID 142516349) has the molecular formula C15H38N2
and a molecular weight of 246.48 g/mol. Its IUPAC name is ethane;N-ethenyl-N-methylpropanimidamide;propane.
Molecular Properties
| Compound Name | ethane;N-ethenyl-N-methylpropanimidamide;propane |
| PubChem CID | 142516349 |
| Molecular Formula | C15H38N2 |
| Molecular Weight | 246.48 g/mol |
| Exact Mass | 246.30 |
| IUPAC Name | ethane;N-ethenyl-N-methylpropanimidamide;propane |
| SMILES | CC.CC.CC.CCC.[H]/N=C(\CC)N(C)C=C |
| InChI | InChI=1S/C6H12N2.C3H8.3C2H6/c1-4-6(7)8(3)5-2;1-3-2;3*1-2/h5,7H,2,4H2,1,3H3;3H2,1-2H3;3*1-2H3/b7-6+;;;; |
| InChIKey | IFHDUSYHJJJBHG-MNPOOLNOSA-N |
| XLogP | 5.94 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 246.48 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-ethenyl-N-methylpropanimidamide;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-ethenyl-N-methylpropanimidamide;propane?
The IUPAC name of ethane;N-ethenyl-N-methylpropanimidamide;propane (CID 142516349) is ethane;N-ethenyl-N-methylpropanimidamide;propane.
What is the SMILES notation for ethane;N-ethenyl-N-methylpropanimidamide;propane?
The canonical SMILES for ethane;N-ethenyl-N-methylpropanimidamide;propane is CC.CC.CC.CCC.[H]/N=C(\CC)N(C)C=C.
What is the InChIKey of ethane;N-ethenyl-N-methylpropanimidamide;propane?
The InChIKey is IFHDUSYHJJJBHG-MNPOOLNOSA-N. The full InChI is InChI=1S/C6H12N2.C3H8.3C2H6/c1-4-6(7)8(3)5-2;1-3-2;3*1-2/h5,7H,2,4H2,1,3H3;3H2,1-2H3;3*1-2H3/b7-6+;;;;.
What are the key properties of ethane;N-ethenyl-N-methylpropanimidamide;propane?
ethane;N-ethenyl-N-methylpropanimidamide;propane has a molecular weight of 246.48 g/mol, XLogP of 5.94, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-ethenyl-N-methylpropanimidamide;propane is sourced from PubChem (CID 142516349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).