C23H24ClF2N3O3 — CID 142516429
5-chloro-2-[(1R,6R)-7,7-difluoro-6-methyl-3-azabicyclo[4.1.0]heptane-3-carbonyl]spiro[6,8-dihydrofuro[2,3-f]quinazoline-9,1'-cyclohexane]-7-one (PubChem CID 142516429) has the molecular formula C23H24ClF2N3O3 and a molecular weight of 463.91 g/mol. Its IUPAC name is 5-chloro-2-[(1R,6R)-7,7-difluoro-6-methyl-3-azabicyclo[4.1.0]heptane-3-carbonyl]spiro[6,8-dihydrofuro[2,3-f]quinazoline-9,1'-cyclohexane]-7-one.
| Compound Name | 5-chloro-2-[(1R,6R)-7,7-difluoro-6-methyl-3-azabicyclo[4.1.0]heptane-3-carbonyl]spiro[6,8-dihydrofuro[2,3-f]quinazoline-9,1'-cyclohexane]-7-one |
|---|---|
| PubChem CID | 142516429 |
| Molecular Formula | C23H24ClF2N3O3 |
| Molecular Weight | 463.91 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | 5-chloro-2-[(1R,6R)-7,7-difluoro-6-methyl-3-azabicyclo[4.1.0]heptane-3-carbonyl]spiro[6,8-dihydrofuro[2,3-f]quinazoline-9,1'-cyclohexane]-7-one |
| SMILES | C[C@@]12CCN(C(=O)c3cc4cc(Cl)c5c(c4o3)C3(CCCCC3)NC(=O)N5)C[C@@H]1C2(F)F |
| InChI | InChI=1S/C23H24ClF2N3O3/c1-21-7-8-29(11-15(21)23(21,25)26)19(30)14-10-12-9-13(24)17-16(18(12)32-14)22(28-20(31)27-17)5-3-2-4-6-22/h9-10,15H,2-8,11H2,1H3,(H2,27,28,31)/t15-,21+/m0/s1 |
| InChIKey | JKICOEAEODXACF-YCRPNKLZSA-N |
| XLogP | 5.50 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.91 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |