About ethane;(2Z)-2-ethylidenepyridin-1-amine;propane
ethane;(2Z)-2-ethylidenepyridin-1-amine;propane (PubChem CID 142516489) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is ethane;(2Z)-2-ethylidenepyridin-1-amine;propane.
Molecular Properties
| Compound Name | ethane;(2Z)-2-ethylidenepyridin-1-amine;propane |
| PubChem CID | 142516489 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | ethane;(2Z)-2-ethylidenepyridin-1-amine;propane |
| SMILES | C/C=C1/C=CC=CN1N.CC.CCC |
| InChI | InChI=1S/C7H10N2.C3H8.C2H6/c1-2-7-5-3-4-6-9(7)8;1-3-2;1-2/h2-6H,8H2,1H3;3H2,1-2H3;1-2H3/b7-2-;; |
| InChIKey | SAYGLGAZTRQQIG-IOXTXXRBSA-N |
| XLogP | 3.59 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze ethane;(2Z)-2-ethylidenepyridin-1-amine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2Z)-2-ethylidenepyridin-1-amine;propane?
The IUPAC name of ethane;(2Z)-2-ethylidenepyridin-1-amine;propane (CID 142516489) is ethane;(2Z)-2-ethylidenepyridin-1-amine;propane.
What is the SMILES notation for ethane;(2Z)-2-ethylidenepyridin-1-amine;propane?
The canonical SMILES for ethane;(2Z)-2-ethylidenepyridin-1-amine;propane is C/C=C1/C=CC=CN1N.CC.CCC.
What is the InChIKey of ethane;(2Z)-2-ethylidenepyridin-1-amine;propane?
The InChIKey is SAYGLGAZTRQQIG-IOXTXXRBSA-N. The full InChI is InChI=1S/C7H10N2.C3H8.C2H6/c1-2-7-5-3-4-6-9(7)8;1-3-2;1-2/h2-6H,8H2,1H3;3H2,1-2H3;1-2H3/b7-2-;;.
What are the key properties of ethane;(2Z)-2-ethylidenepyridin-1-amine;propane?
ethane;(2Z)-2-ethylidenepyridin-1-amine;propane has a molecular weight of 196.34 g/mol, XLogP of 3.59, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2Z)-2-ethylidenepyridin-1-amine;propane is sourced from PubChem (CID 142516489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).