C19H21N3O — CID 142517423
(Z,Z)-N-[1-[2-(1-azacyclohepta-2,5,6-trien-1-yl)ethoxy]ethenyl]-2-pyridin-2-ylbut-2-en-1-imine (PubChem CID 142517423) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is (Z,Z)-N-[1-[2-(1-azacyclohepta-2,5,6-trien-1-yl)ethoxy]ethenyl]-2-pyridin-2-ylbut-2-en-1-imine.
| Compound Name | (Z,Z)-N-[1-[2-(1-azacyclohepta-2,5,6-trien-1-yl)ethoxy]ethenyl]-2-pyridin-2-ylbut-2-en-1-imine |
|---|---|
| PubChem CID | 142517423 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | (Z,Z)-N-[1-[2-(1-azacyclohepta-2,5,6-trien-1-yl)ethoxy]ethenyl]-2-pyridin-2-ylbut-2-en-1-imine |
| SMILES | C=C(/N=C\C(=C/C)c1ccccn1)OCCN1C=C=CCC=C1 |
| InChI | InChI=1S/C19H21N3O/c1-3-18(19-10-6-7-11-20-19)16-21-17(2)23-15-14-22-12-8-4-5-9-13-22/h3-4,6-7,9-13,16H,2,5,14-15H2,1H3/b18-3+,21-16- |
| InChIKey | CYCOAECZOLURDV-VKUNKSRJSA-N |
| XLogP | 3.93 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|