C17H27N3O — CID 142517637
(E)-N-[1-(1-methylpiperidin-4-yl)oxyethyl]-2-pyridin-2-ylbut-2-en-1-amine (PubChem CID 142517637) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is (E)-N-[1-(1-methylpiperidin-4-yl)oxyethyl]-2-pyridin-2-ylbut-2-en-1-amine.
| Compound Name | (E)-N-[1-(1-methylpiperidin-4-yl)oxyethyl]-2-pyridin-2-ylbut-2-en-1-amine |
|---|---|
| PubChem CID | 142517637 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | (E)-N-[1-(1-methylpiperidin-4-yl)oxyethyl]-2-pyridin-2-ylbut-2-en-1-amine |
| SMILES | C/C=C(\CNC(C)OC1CCN(C)CC1)c1ccccn1 |
| InChI | InChI=1S/C17H27N3O/c1-4-15(17-7-5-6-10-18-17)13-19-14(2)21-16-8-11-20(3)12-9-16/h4-7,10,14,16,19H,8-9,11-13H2,1-3H3/b15-4+ |
| InChIKey | BVPJPYXLJLFNRN-SYZQJQIISA-N |
| XLogP | 2.53 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|