C12H18N4O — CID 142517931
6-morpholin-4-yl-3-N-prop-1-en-2-ylpyridine-2,3-diamine (PubChem CID 142517931) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is 6-morpholin-4-yl-3-N-prop-1-en-2-ylpyridine-2,3-diamine.
| Compound Name | 6-morpholin-4-yl-3-N-prop-1-en-2-ylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 142517931 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 6-morpholin-4-yl-3-N-prop-1-en-2-ylpyridine-2,3-diamine |
| SMILES | C=C(C)Nc1ccc(N2CCOCC2)nc1N |
| InChI | InChI=1S/C12H18N4O/c1-9(2)14-10-3-4-11(15-12(10)13)16-5-7-17-8-6-16/h3-4,14H,1,5-8H2,2H3,(H2,13,15) |
| InChIKey | ATBUXGHXGIDOTR-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |