About CID 142518568
CID 142518568 (PubChem CID 142518568) has the molecular formula C32H34F3N5O4Si-
and a molecular weight of 637.74 g/mol.
Molecular Properties
| Compound Name | CID 142518568 |
| PubChem CID | 142518568 |
| Molecular Formula | C32H34F3N5O4Si- |
| Molecular Weight | 637.74 g/mol |
| Exact Mass | 637.23 |
| IUPAC Name | — |
| SMILES | CC(NC(=O)Nc1cc(F)c(Oc2ccnc3c2c(-c2cccc(F)c2C#N)cn3COCC[Si-](C)(C)C)c(F)c1)C1COC1 |
| InChI | InChI=1S/C32H34F3N5O4Si/c1-19(20-16-43-17-20)38-32(41)39-21-12-26(34)30(27(35)13-21)44-28-8-9-37-31-29(28)24(22-6-5-7-25(33)23(22)14-36)15-40(31)18-42-10-11-45(2,3)4/h5-9,12-13,15,19-20H,10-11,16-18H2,1-4H3,(H2,38,39,41)/q-1 |
| InChIKey | GZVAWUBAEOCNIB-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 110.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 637.74 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 142518568 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 142518568?
The IUPAC name of CID 142518568 (CID 142518568) is not available.
What is the SMILES notation for CID 142518568?
The canonical SMILES for CID 142518568 is CC(NC(=O)Nc1cc(F)c(Oc2ccnc3c2c(-c2cccc(F)c2C#N)cn3COCC[Si-](C)(C)C)c(F)c1)C1COC1.
What is the InChIKey of CID 142518568?
The InChIKey is GZVAWUBAEOCNIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H34F3N5O4Si/c1-19(20-16-43-17-20)38-32(41)39-21-12-26(34)30(27(35)13-21)44-28-8-9-37-31-29(28)24(22-6-5-7-25(33)23(22)14-36)15-40(31)18-42-10-11-45(2,3)4/h5-9,12-13,15,19-20H,10-11,16-18H2,1-4H3,(H2,38,39,41)/q-1.
What are the key properties of CID 142518568?
CID 142518568 has a molecular weight of 637.74 g/mol, XLogP of 7.25, 11 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 142518568 is sourced from PubChem (CID 142518568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).