About 4-(butoxymethyl)phenol
4-(butoxymethyl)phenol (PubChem CID 14251857) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is 4-(butoxymethyl)phenol.
Molecular Properties
| Compound Name | 4-(butoxymethyl)phenol |
| PubChem CID | 14251857 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 4-(butoxymethyl)phenol |
| SMILES | CCCCOCc1ccc(O)cc1 |
| InChI | InChI=1S/C11H16O2/c1-2-3-8-13-9-10-4-6-11(12)7-5-10/h4-7,12H,2-3,8-9H2,1H3 |
| InChIKey | GGPCJIKQXDNJJY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(butoxymethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(butoxymethyl)phenol?
The IUPAC name of 4-(butoxymethyl)phenol (CID 14251857) is 4-(butoxymethyl)phenol.
What is the SMILES notation for 4-(butoxymethyl)phenol?
The canonical SMILES for 4-(butoxymethyl)phenol is CCCCOCc1ccc(O)cc1.
What is the InChIKey of 4-(butoxymethyl)phenol?
The InChIKey is GGPCJIKQXDNJJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2/c1-2-3-8-13-9-10-4-6-11(12)7-5-10/h4-7,12H,2-3,8-9H2,1H3.
What are the key properties of 4-(butoxymethyl)phenol?
4-(butoxymethyl)phenol has a molecular weight of 180.25 g/mol, XLogP of 2.71, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(butoxymethyl)phenol is sourced from PubChem (CID 14251857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).