C10H19F3N2O2 — CID 142518883
2-[1-methoxypropyl(2,2,2-trifluoroethyl)amino]-N,N-dimethylacetamide (PubChem CID 142518883) has the molecular formula C10H19F3N2O2 and a molecular weight of 256.27 g/mol. Its IUPAC name is 2-[1-methoxypropyl(2,2,2-trifluoroethyl)amino]-N,N-dimethylacetamide.
| Compound Name | 2-[1-methoxypropyl(2,2,2-trifluoroethyl)amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 142518883 |
| Molecular Formula | C10H19F3N2O2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 2-[1-methoxypropyl(2,2,2-trifluoroethyl)amino]-N,N-dimethylacetamide |
| SMILES | CCC(OC)N(CC(=O)N(C)C)CC(F)(F)F |
| InChI | InChI=1S/C10H19F3N2O2/c1-5-9(17-4)15(7-10(11,12)13)6-8(16)14(2)3/h9H,5-7H2,1-4H3 |
| InChIKey | WTQPORAZQVWPNV-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|