About 2-[9-(2,6-diphenylpyrimidin-4-yl)dibenzofuran-4-yl]quinoxaline
2-[9-(2,6-diphenylpyrimidin-4-yl)dibenzofuran-4-yl]quinoxaline (PubChem CID 142519100) has the molecular formula C36H22N4O
and a molecular weight of 526.60 g/mol. Its IUPAC name is 2-[9-(2,6-diphenylpyrimidin-4-yl)dibenzofuran-4-yl]quinoxaline.
Molecular Properties
| Compound Name | 2-[9-(2,6-diphenylpyrimidin-4-yl)dibenzofuran-4-yl]quinoxaline |
| PubChem CID | 142519100 |
| Molecular Formula | C36H22N4O |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | 2-[9-(2,6-diphenylpyrimidin-4-yl)dibenzofuran-4-yl]quinoxaline |
| SMILES | c1ccc(-c2cc(-c3cccc4oc5c(-c6cnc7ccccc7n6)cccc5c34)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C36H22N4O/c1-3-11-23(12-4-1)30-21-31(40-36(39-30)24-13-5-2-6-14-24)25-15-10-20-33-34(25)27-17-9-16-26(35(27)41-33)32-22-37-28-18-7-8-19-29(28)38-32/h1-22H |
| InChIKey | SOIUIGKBDPPJOX-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[9-(2,6-diphenylpyrimidin-4-yl)dibenzofuran-4-yl]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[9-(2,6-diphenylpyrimidin-4-yl)dibenzofuran-4-yl]quinoxaline?
The IUPAC name of 2-[9-(2,6-diphenylpyrimidin-4-yl)dibenzofuran-4-yl]quinoxaline (CID 142519100) is 2-[9-(2,6-diphenylpyrimidin-4-yl)dibenzofuran-4-yl]quinoxaline.
What is the SMILES notation for 2-[9-(2,6-diphenylpyrimidin-4-yl)dibenzofuran-4-yl]quinoxaline?
The canonical SMILES for 2-[9-(2,6-diphenylpyrimidin-4-yl)dibenzofuran-4-yl]quinoxaline is c1ccc(-c2cc(-c3cccc4oc5c(-c6cnc7ccccc7n6)cccc5c34)nc(-c3ccccc3)n2)cc1.
What is the InChIKey of 2-[9-(2,6-diphenylpyrimidin-4-yl)dibenzofuran-4-yl]quinoxaline?
The InChIKey is SOIUIGKBDPPJOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H22N4O/c1-3-11-23(12-4-1)30-21-31(40-36(39-30)24-13-5-2-6-14-24)25-15-10-20-33-34(25)27-17-9-16-26(35(27)41-33)32-22-37-28-18-7-8-19-29(28)38-32/h1-22H.
What are the key properties of 2-[9-(2,6-diphenylpyrimidin-4-yl)dibenzofuran-4-yl]quinoxaline?
2-[9-(2,6-diphenylpyrimidin-4-yl)dibenzofuran-4-yl]quinoxaline has a molecular weight of 526.60 g/mol, XLogP of 8.99, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[9-(2,6-diphenylpyrimidin-4-yl)dibenzofuran-4-yl]quinoxaline is sourced from PubChem (CID 142519100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).