C49H33N5O3 — CID 142519269
2-(benzenecarboximidoyl)-1-benzofuran-3-amine;2-dibenzofuran-4-yl-4-(9-methyldibenzofuran-1-yl)-6-phenyl-1,3,5-triazine (PubChem CID 142519269) has the molecular formula C49H33N5O3 and a molecular weight of 739.84 g/mol. Its IUPAC name is 2-(benzenecarboximidoyl)-1-benzofuran-3-amine;2-dibenzofuran-4-yl-4-(9-methyldibenzofuran-1-yl)-6-phenyl-1,3,5-triazine.
| Compound Name | 2-(benzenecarboximidoyl)-1-benzofuran-3-amine;2-dibenzofuran-4-yl-4-(9-methyldibenzofuran-1-yl)-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 142519269 |
| Molecular Formula | C49H33N5O3 |
| Molecular Weight | 739.84 g/mol |
| Exact Mass | 739.26 |
| IUPAC Name | 2-(benzenecarboximidoyl)-1-benzofuran-3-amine;2-dibenzofuran-4-yl-4-(9-methyldibenzofuran-1-yl)-6-phenyl-1,3,5-triazine |
| SMILES | Cc1cccc2oc3cccc(-c4nc(-c5ccccc5)nc(-c5cccc6c5oc5ccccc56)n4)c3c12.[H]/N=C(\c1ccccc1)c1oc2ccccc2c1N |
| InChI | InChI=1S/C34H21N3O2.C15H12N2O/c1-20-10-7-18-27-29(20)30-24(15-9-19-28(30)38-27)33-35-32(21-11-3-2-4-12-21)36-34(37-33)25-16-8-14-23-22-13-5-6-17-26(22)39-31(23)25;16-13(10-6-2-1-3-7-10)15-14(17)11-8-4-5-9-12(11)18-15/h2-19H,1H3;1-9,16H,17H2/b;16-13+ |
| InChIKey | PRUFEQZQMHIHLX-MDPUXWEUSA-N |
| XLogP | 12.41 |
| TPSA | 127.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.84 |
| LogP ≤ 5 | 12.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|