C51H37N5OS — CID 142519352
2-[2-ethenyl-3-[(E)-1-[4-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]-6-phenyl-1,3,5-triazin-2-yl]prop-1-enyl]-1-benzofuran-6-yl]-4-phenyl-[1]benzothiolo[3,2-d]pyrimidine (PubChem CID 142519352) has the molecular formula C51H37N5OS and a molecular weight of 767.96 g/mol. Its IUPAC name is 2-[2-ethenyl-3-[(E)-1-[4-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]-6-phenyl-1,3,5-triazin-2-yl]prop-1-enyl]-1-benzofuran-6-yl]-4-phenyl-[1]benzothiolo[3,2-d]pyrimidine.
| Compound Name | 2-[2-ethenyl-3-[(E)-1-[4-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]-6-phenyl-1,3,5-triazin-2-yl]prop-1-enyl]-1-benzofuran-6-yl]-4-phenyl-[1]benzothiolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 142519352 |
| Molecular Formula | C51H37N5OS |
| Molecular Weight | 767.96 g/mol |
| Exact Mass | 767.27 |
| IUPAC Name | 2-[2-ethenyl-3-[(E)-1-[4-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]-6-phenyl-1,3,5-triazin-2-yl]prop-1-enyl]-1-benzofuran-6-yl]-4-phenyl-[1]benzothiolo[3,2-d]pyrimidine |
| SMILES | C=C/C=C(\C=C/C)c1ccc(-c2nc(/C(=C/C)c3c(C=C)oc4cc(-c5nc(-c6ccccc6)c6sc7ccccc7c6n5)ccc34)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C51H37N5OS/c1-5-17-32(18-6-2)33-25-27-36(28-26-33)49-54-48(35-21-13-10-14-22-35)55-51(56-49)38(7-3)44-39-30-29-37(31-42(39)57-41(44)8-4)50-52-45(34-19-11-9-12-20-34)47-46(53-50)40-23-15-16-24-43(40)58-47/h5-31H,1,4H2,2-3H3/b18-6-,32-17+,38-7+ |
| InChIKey | PVXSSGGHNQCJNG-OURGXWNJSA-N |
| XLogP | 13.68 |
| TPSA | 77.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.96 |
| LogP ≤ 5 | 13.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|