About methyl 6-(fluoromethyl)-1-phenyltricyclo[4.3.1.13,8]undecane-3-carboxylate
methyl 6-(fluoromethyl)-1-phenyltricyclo[4.3.1.13,8]undecane-3-carboxylate (PubChem CID 142519981) has the molecular formula C20H25FO2
and a molecular weight of 316.42 g/mol. Its IUPAC name is methyl 6-(fluoromethyl)-1-phenyltricyclo[4.3.1.13,8]undecane-3-carboxylate.
Molecular Properties
| Compound Name | methyl 6-(fluoromethyl)-1-phenyltricyclo[4.3.1.13,8]undecane-3-carboxylate |
| PubChem CID | 142519981 |
| Molecular Formula | C20H25FO2 |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | methyl 6-(fluoromethyl)-1-phenyltricyclo[4.3.1.13,8]undecane-3-carboxylate |
| SMILES | COC(=O)C12CCC3(CF)CC(C1)CC(c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C20H25FO2/c1-23-17(22)19-8-7-18(14-21)9-15(10-19)11-20(12-18,13-19)16-5-3-2-4-6-16/h2-6,15H,7-14H2,1H3 |
| InChIKey | FCOMKYBENYHSDJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 6-(fluoromethyl)-1-phenyltricyclo[4.3.1.13,8]undecane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-(fluoromethyl)-1-phenyltricyclo[4.3.1.13,8]undecane-3-carboxylate?
The IUPAC name of methyl 6-(fluoromethyl)-1-phenyltricyclo[4.3.1.13,8]undecane-3-carboxylate (CID 142519981) is methyl 6-(fluoromethyl)-1-phenyltricyclo[4.3.1.13,8]undecane-3-carboxylate.
What is the SMILES notation for methyl 6-(fluoromethyl)-1-phenyltricyclo[4.3.1.13,8]undecane-3-carboxylate?
The canonical SMILES for methyl 6-(fluoromethyl)-1-phenyltricyclo[4.3.1.13,8]undecane-3-carboxylate is COC(=O)C12CCC3(CF)CC(C1)CC(c1ccccc1)(C3)C2.
What is the InChIKey of methyl 6-(fluoromethyl)-1-phenyltricyclo[4.3.1.13,8]undecane-3-carboxylate?
The InChIKey is FCOMKYBENYHSDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25FO2/c1-23-17(22)19-8-7-18(14-21)9-15(10-19)11-20(12-18,13-19)16-5-3-2-4-6-16/h2-6,15H,7-14H2,1H3.
What are the key properties of methyl 6-(fluoromethyl)-1-phenyltricyclo[4.3.1.13,8]undecane-3-carboxylate?
methyl 6-(fluoromethyl)-1-phenyltricyclo[4.3.1.13,8]undecane-3-carboxylate has a molecular weight of 316.42 g/mol, XLogP of 4.43, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-(fluoromethyl)-1-phenyltricyclo[4.3.1.13,8]undecane-3-carboxylate is sourced from PubChem (CID 142519981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).