C18H33N9O4S2 — CID 142520227
3-(3-amino-2-hydroxypropyl)sulfinamoyl-6-[[(E)-[2-(aminomethyl)-3-methylcyclopentylidene]methyl]amino]-N'-hydrazinyl-2-sulfamoylbenzenecarboximidamide (PubChem CID 142520227) has the molecular formula C18H33N9O4S2 and a molecular weight of 503.66 g/mol. Its IUPAC name is 3-(3-amino-2-hydroxypropyl)sulfinamoyl-6-[[(E)-[2-(aminomethyl)-3-methylcyclopentylidene]methyl]amino]-N'-hydrazinyl-2-sulfamoylbenzenecarboximidamide.
| Compound Name | 3-(3-amino-2-hydroxypropyl)sulfinamoyl-6-[[(E)-[2-(aminomethyl)-3-methylcyclopentylidene]methyl]amino]-N'-hydrazinyl-2-sulfamoylbenzenecarboximidamide |
|---|---|
| PubChem CID | 142520227 |
| Molecular Formula | C18H33N9O4S2 |
| Molecular Weight | 503.66 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | 3-(3-amino-2-hydroxypropyl)sulfinamoyl-6-[[(E)-[2-(aminomethyl)-3-methylcyclopentylidene]methyl]amino]-N'-hydrazinyl-2-sulfamoylbenzenecarboximidamide |
| SMILES | CC1CC/C(=C\Nc2ccc(S(=O)NCC(O)CN)c(S(N)(=O)=O)c2/C(N)=N/NN)C1CN |
| InChI | InChI=1S/C18H33N9O4S2/c1-10-2-3-11(13(10)7-20)8-24-14-4-5-15(32(29)25-9-12(28)6-19)17(33(23,30)31)16(14)18(21)26-27-22/h4-5,8,10,12-13,24-25,27-28H,2-3,6-7,9,19-20,22H2,1H3,(H2,21,26)(H2,23,30,31)/b11-8+ |
| InChIKey | LIRORIWHKBHLLF-DHZHZOJOSA-N |
| XLogP | -2.35 |
| TPSA | 249.99 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.66 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|