About ethane;3-ethyl-N-methylpyrazin-2-amine;2-ethyl-N-methylpyridin-3-amine
ethane;3-ethyl-N-methylpyrazin-2-amine;2-ethyl-N-methylpyridin-3-amine (PubChem CID 142520346) has the molecular formula C21H41N5
and a molecular weight of 363.59 g/mol. Its IUPAC name is ethane;3-ethyl-N-methylpyrazin-2-amine;2-ethyl-N-methylpyridin-3-amine.
Molecular Properties
| Compound Name | ethane;3-ethyl-N-methylpyrazin-2-amine;2-ethyl-N-methylpyridin-3-amine |
| PubChem CID | 142520346 |
| Molecular Formula | C21H41N5 |
| Molecular Weight | 363.59 g/mol |
| Exact Mass | 363.34 |
| IUPAC Name | ethane;3-ethyl-N-methylpyrazin-2-amine;2-ethyl-N-methylpyridin-3-amine |
| SMILES | CC.CC.CC.CCc1ncccc1NC.CCc1nccnc1NC |
| InChI | InChI=1S/C8H12N2.C7H11N3.3C2H6/c1-3-7-8(9-2)5-4-6-10-7;1-3-6-7(8-2)10-5-4-9-6;3*1-2/h4-6,9H,3H2,1-2H3;4-5H,3H2,1-2H3,(H,8,10);3*1-2H3 |
| InChIKey | XJEDOBZMUCGODI-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.59 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethane;3-ethyl-N-methylpyrazin-2-amine;2-ethyl-N-methylpyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-ethyl-N-methylpyrazin-2-amine;2-ethyl-N-methylpyridin-3-amine?
The IUPAC name of ethane;3-ethyl-N-methylpyrazin-2-amine;2-ethyl-N-methylpyridin-3-amine (CID 142520346) is ethane;3-ethyl-N-methylpyrazin-2-amine;2-ethyl-N-methylpyridin-3-amine.
What is the SMILES notation for ethane;3-ethyl-N-methylpyrazin-2-amine;2-ethyl-N-methylpyridin-3-amine?
The canonical SMILES for ethane;3-ethyl-N-methylpyrazin-2-amine;2-ethyl-N-methylpyridin-3-amine is CC.CC.CC.CCc1ncccc1NC.CCc1nccnc1NC.
What is the InChIKey of ethane;3-ethyl-N-methylpyrazin-2-amine;2-ethyl-N-methylpyridin-3-amine?
The InChIKey is XJEDOBZMUCGODI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2.C7H11N3.3C2H6/c1-3-7-8(9-2)5-4-6-10-7;1-3-6-7(8-2)10-5-4-9-6;3*1-2/h4-6,9H,3H2,1-2H3;4-5H,3H2,1-2H3,(H,8,10);3*1-2H3.
What are the key properties of ethane;3-ethyl-N-methylpyrazin-2-amine;2-ethyl-N-methylpyridin-3-amine?
ethane;3-ethyl-N-methylpyrazin-2-amine;2-ethyl-N-methylpyridin-3-amine has a molecular weight of 363.59 g/mol, XLogP of 5.84, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-ethyl-N-methylpyrazin-2-amine;2-ethyl-N-methylpyridin-3-amine is sourced from PubChem (CID 142520346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).