C19H25BFN3O3 — CID 142520460
N-[3-fluoro-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N,2-dimethylpyrazole-3-carboxamide (PubChem CID 142520460) has the molecular formula C19H25BFN3O3 and a molecular weight of 373.24 g/mol. Its IUPAC name is N-[3-fluoro-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N,2-dimethylpyrazole-3-carboxamide.
| Compound Name | N-[3-fluoro-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N,2-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 142520460 |
| Molecular Formula | C19H25BFN3O3 |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | N-[3-fluoro-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N,2-dimethylpyrazole-3-carboxamide |
| SMILES | Cc1c(N(C)C(=O)c2ccnn2C)ccc(B2OC(C)(C)C(C)(C)O2)c1F |
| InChI | InChI=1S/C19H25BFN3O3/c1-12-14(23(6)17(25)15-10-11-22-24(15)7)9-8-13(16(12)21)20-26-18(2,3)19(4,5)27-20/h8-11H,1-7H3 |
| InChIKey | NFUAMWRCUCRPRI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|