About 7-fluoro-9-methyl-2,3-dihydro-1H-1-benzazepine
7-fluoro-9-methyl-2,3-dihydro-1H-1-benzazepine (PubChem CID 142520484) has the molecular formula C11H12FN
and a molecular weight of 177.22 g/mol. Its IUPAC name is 7-fluoro-9-methyl-2,3-dihydro-1H-1-benzazepine.
Molecular Properties
| Compound Name | 7-fluoro-9-methyl-2,3-dihydro-1H-1-benzazepine |
| PubChem CID | 142520484 |
| Molecular Formula | C11H12FN |
| Molecular Weight | 177.22 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 7-fluoro-9-methyl-2,3-dihydro-1H-1-benzazepine |
| SMILES | Cc1cc(F)cc2c1NCCC=C2 |
| InChI | InChI=1S/C11H12FN/c1-8-6-10(12)7-9-4-2-3-5-13-11(8)9/h2,4,6-7,13H,3,5H2,1H3 |
| InChIKey | WBJBFRLIJZSPDE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.22 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-fluoro-9-methyl-2,3-dihydro-1H-1-benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-9-methyl-2,3-dihydro-1H-1-benzazepine?
The IUPAC name of 7-fluoro-9-methyl-2,3-dihydro-1H-1-benzazepine (CID 142520484) is 7-fluoro-9-methyl-2,3-dihydro-1H-1-benzazepine.
What is the SMILES notation for 7-fluoro-9-methyl-2,3-dihydro-1H-1-benzazepine?
The canonical SMILES for 7-fluoro-9-methyl-2,3-dihydro-1H-1-benzazepine is Cc1cc(F)cc2c1NCCC=C2.
What is the InChIKey of 7-fluoro-9-methyl-2,3-dihydro-1H-1-benzazepine?
The InChIKey is WBJBFRLIJZSPDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12FN/c1-8-6-10(12)7-9-4-2-3-5-13-11(8)9/h2,4,6-7,13H,3,5H2,1H3.
What are the key properties of 7-fluoro-9-methyl-2,3-dihydro-1H-1-benzazepine?
7-fluoro-9-methyl-2,3-dihydro-1H-1-benzazepine has a molecular weight of 177.22 g/mol, XLogP of 2.96, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-9-methyl-2,3-dihydro-1H-1-benzazepine is sourced from PubChem (CID 142520484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).