C10H21AsO9S — CID 14252073
(2R)-3-[(2R,3R,4S,5S)-5-(dimethylarsorylmethyl)-3,4-dihydroxyoxolan-2-yl]oxy-2-hydroxypropane-1-sulfonic acid (PubChem CID 14252073) has the molecular formula C10H21AsO9S and a molecular weight of 392.26 g/mol. Its IUPAC name is (2R)-3-[(2R,3R,4S,5S)-5-(dimethylarsorylmethyl)-3,4-dihydroxyoxolan-2-yl]oxy-2-hydroxypropane-1-sulfonic acid.
| Compound Name | (2R)-3-[(2R,3R,4S,5S)-5-(dimethylarsorylmethyl)-3,4-dihydroxyoxolan-2-yl]oxy-2-hydroxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 14252073 |
| Molecular Formula | C10H21AsO9S |
| Molecular Weight | 392.26 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | (2R)-3-[(2R,3R,4S,5S)-5-(dimethylarsorylmethyl)-3,4-dihydroxyoxolan-2-yl]oxy-2-hydroxypropane-1-sulfonic acid |
| SMILES | C[As](C)(=O)C[C@H]1O[C@@H](OC[C@@H](O)CS(=O)(=O)O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H21AsO9S/c1-11(2,15)3-7-8(13)9(14)10(20-7)19-4-6(12)5-21(16,17)18/h6-10,12-14H,3-5H2,1-2H3,(H,16,17,18)/t6-,7-,8-,9-,10-/m1/s1 |
| InChIKey | KSWXPPREIUKIQL-VVULQXIFSA-N |
| XLogP | -1.67 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.26 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|