C53H49F3N2O3S — CID 142521140
[3-[2-[4-(4-tert-butyl-2-pyridinyl)phenyl]phenyl]-5-[2-[4-methyl-6-(1,1,3,3-tetramethyl-2H-inden-5-yl)-3-pyridinyl]phenyl]phenyl] trifluoromethanesulfonate (PubChem CID 142521140) has the molecular formula C53H49F3N2O3S and a molecular weight of 851.05 g/mol. Its IUPAC name is [3-[2-[4-(4-tert-butyl-2-pyridinyl)phenyl]phenyl]-5-[2-[4-methyl-6-(1,1,3,3-tetramethyl-2H-inden-5-yl)-3-pyridinyl]phenyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3-[2-[4-(4-tert-butyl-2-pyridinyl)phenyl]phenyl]-5-[2-[4-methyl-6-(1,1,3,3-tetramethyl-2H-inden-5-yl)-3-pyridinyl]phenyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 142521140 |
| Molecular Formula | C53H49F3N2O3S |
| Molecular Weight | 851.05 g/mol |
| Exact Mass | 850.34 |
| IUPAC Name | [3-[2-[4-(4-tert-butyl-2-pyridinyl)phenyl]phenyl]-5-[2-[4-methyl-6-(1,1,3,3-tetramethyl-2H-inden-5-yl)-3-pyridinyl]phenyl]phenyl] trifluoromethanesulfonate |
| SMILES | Cc1cc(-c2ccc3c(c2)C(C)(C)CC3(C)C)ncc1-c1ccccc1-c1cc(OS(=O)(=O)C(F)(F)F)cc(-c2ccccc2-c2ccc(-c3cc(C(C)(C)C)ccn3)cc2)c1 |
| InChI | InChI=1S/C53H49F3N2O3S/c1-33-25-48(36-21-22-46-47(29-36)52(7,8)32-51(46,5)6)58-31-45(33)44-16-12-11-15-43(44)38-26-37(27-40(28-38)61-62(59,60)53(54,55)56)42-14-10-9-13-41(42)34-17-19-35(20-18-34)49-30-39(23-24-57-49)50(2,3)4/h9-31H,32H2,1-8H3 |
| InChIKey | MRJRWMGICAFBMI-UHFFFAOYSA-N |
| XLogP | 14.27 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.05 |
| LogP ≤ 5 | 14.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|