About (2R)-N-methoxy-2,6-dimethyloxan-4-imine;hydrate
(2R)-N-methoxy-2,6-dimethyloxan-4-imine;hydrate (PubChem CID 142521489) has the molecular formula C8H17NO3
and a molecular weight of 175.23 g/mol. Its IUPAC name is (2R)-N-methoxy-2,6-dimethyloxan-4-imine;hydrate.
Molecular Properties
| Compound Name | (2R)-N-methoxy-2,6-dimethyloxan-4-imine;hydrate |
| PubChem CID | 142521489 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | (2R)-N-methoxy-2,6-dimethyloxan-4-imine;hydrate |
| SMILES | CO/N=C1/CC(C)O[C@H](C)C1.O |
| InChI | InChI=1S/C8H15NO2.H2O/c1-6-4-8(9-10-3)5-7(2)11-6;/h6-7H,4-5H2,1-3H3;1H2/b9-8-;/t6?,7-;/m1./s1 |
| InChIKey | DTUNDRBJXAVPLD-OSWZLHSHSA-N |
| XLogP | 0.75 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R)-N-methoxy-2,6-dimethyloxan-4-imine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-methoxy-2,6-dimethyloxan-4-imine;hydrate?
The IUPAC name of (2R)-N-methoxy-2,6-dimethyloxan-4-imine;hydrate (CID 142521489) is (2R)-N-methoxy-2,6-dimethyloxan-4-imine;hydrate.
What is the SMILES notation for (2R)-N-methoxy-2,6-dimethyloxan-4-imine;hydrate?
The canonical SMILES for (2R)-N-methoxy-2,6-dimethyloxan-4-imine;hydrate is CO/N=C1/CC(C)O[C@H](C)C1.O.
What is the InChIKey of (2R)-N-methoxy-2,6-dimethyloxan-4-imine;hydrate?
The InChIKey is DTUNDRBJXAVPLD-OSWZLHSHSA-N. The full InChI is InChI=1S/C8H15NO2.H2O/c1-6-4-8(9-10-3)5-7(2)11-6;/h6-7H,4-5H2,1-3H3;1H2/b9-8-;/t6?,7-;/m1./s1.
What are the key properties of (2R)-N-methoxy-2,6-dimethyloxan-4-imine;hydrate?
(2R)-N-methoxy-2,6-dimethyloxan-4-imine;hydrate has a molecular weight of 175.23 g/mol, XLogP of 0.75, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-methoxy-2,6-dimethyloxan-4-imine;hydrate is sourced from PubChem (CID 142521489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).