C9H13F3N2O — CID 142521701
2,4-dimethyl-6-(trifluoromethyl)pyridazin-3-one;ethane (PubChem CID 142521701) has the molecular formula C9H13F3N2O and a molecular weight of 222.21 g/mol. Its IUPAC name is 2,4-dimethyl-6-(trifluoromethyl)pyridazin-3-one;ethane.
| Compound Name | 2,4-dimethyl-6-(trifluoromethyl)pyridazin-3-one;ethane |
|---|---|
| PubChem CID | 142521701 |
| Molecular Formula | C9H13F3N2O |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 2,4-dimethyl-6-(trifluoromethyl)pyridazin-3-one;ethane |
| SMILES | CC.Cc1cc(C(F)(F)F)nn(C)c1=O |
| InChI | InChI=1S/C7H7F3N2O.C2H6/c1-4-3-5(7(8,9)10)11-12(2)6(4)13;1-2/h3H,1-2H3;1-2H3 |
| InChIKey | HNRPPAFTGYAJNN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |