C24H20F2N2O4 — CID 142521702
2-(4-but-2-ynyl-7-fluoro-3-oxospiro[1,4-benzoxazine-2,1'-cyclopropane]-6-yl)-5-fluoroisoindole-1,3-dione;ethane (PubChem CID 142521702) has the molecular formula C24H20F2N2O4 and a molecular weight of 438.43 g/mol. Its IUPAC name is 2-(4-but-2-ynyl-7-fluoro-3-oxospiro[1,4-benzoxazine-2,1'-cyclopropane]-6-yl)-5-fluoroisoindole-1,3-dione;ethane.
| Compound Name | 2-(4-but-2-ynyl-7-fluoro-3-oxospiro[1,4-benzoxazine-2,1'-cyclopropane]-6-yl)-5-fluoroisoindole-1,3-dione;ethane |
|---|---|
| PubChem CID | 142521702 |
| Molecular Formula | C24H20F2N2O4 |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 2-(4-but-2-ynyl-7-fluoro-3-oxospiro[1,4-benzoxazine-2,1'-cyclopropane]-6-yl)-5-fluoroisoindole-1,3-dione;ethane |
| SMILES | CC.CC#CCN1C(=O)C2(CC2)Oc2cc(F)c(N3C(=O)c4ccc(F)cc4C3=O)cc21 |
| InChI | InChI=1S/C22H14F2N2O4.C2H6/c1-2-3-8-25-17-11-16(15(24)10-18(17)30-22(6-7-22)21(25)29)26-19(27)13-5-4-12(23)9-14(13)20(26)28;1-2/h4-5,9-11H,6-8H2,1H3;1-2H3 |
| InChIKey | NHYLOABURKWCJI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|