About 5-methylhex-5-enyl 2,2,2-trichloroacetate
5-methylhex-5-enyl 2,2,2-trichloroacetate (PubChem CID 142521941) has the molecular formula C9H13Cl3O2
and a molecular weight of 259.56 g/mol. Its IUPAC name is 5-methylhex-5-enyl 2,2,2-trichloroacetate.
Molecular Properties
| Compound Name | 5-methylhex-5-enyl 2,2,2-trichloroacetate |
| PubChem CID | 142521941 |
| Molecular Formula | C9H13Cl3O2 |
| Molecular Weight | 259.56 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | 5-methylhex-5-enyl 2,2,2-trichloroacetate |
| SMILES | C=C(C)CCCCOC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H13Cl3O2/c1-7(2)5-3-4-6-14-8(13)9(10,11)12/h1,3-6H2,2H3 |
| InChIKey | ZYLOQQJCQRNAMJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.56 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methylhex-5-enyl 2,2,2-trichloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylhex-5-enyl 2,2,2-trichloroacetate?
The IUPAC name of 5-methylhex-5-enyl 2,2,2-trichloroacetate (CID 142521941) is 5-methylhex-5-enyl 2,2,2-trichloroacetate.
What is the SMILES notation for 5-methylhex-5-enyl 2,2,2-trichloroacetate?
The canonical SMILES for 5-methylhex-5-enyl 2,2,2-trichloroacetate is C=C(C)CCCCOC(=O)C(Cl)(Cl)Cl.
What is the InChIKey of 5-methylhex-5-enyl 2,2,2-trichloroacetate?
The InChIKey is ZYLOQQJCQRNAMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13Cl3O2/c1-7(2)5-3-4-6-14-8(13)9(10,11)12/h1,3-6H2,2H3.
What are the key properties of 5-methylhex-5-enyl 2,2,2-trichloroacetate?
5-methylhex-5-enyl 2,2,2-trichloroacetate has a molecular weight of 259.56 g/mol, XLogP of 3.65, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylhex-5-enyl 2,2,2-trichloroacetate is sourced from PubChem (CID 142521941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).