C25H31N5O2S — CID 142522212
N-[2-[1-[(3,4-dimethoxyphenyl)-(6-ethyl-1,3-benzothiazol-2-yl)methyl]triazol-4-yl]ethyl]propan-1-amine (PubChem CID 142522212) has the molecular formula C25H31N5O2S and a molecular weight of 465.62 g/mol. Its IUPAC name is N-[2-[1-[(3,4-dimethoxyphenyl)-(6-ethyl-1,3-benzothiazol-2-yl)methyl]triazol-4-yl]ethyl]propan-1-amine.
| Compound Name | N-[2-[1-[(3,4-dimethoxyphenyl)-(6-ethyl-1,3-benzothiazol-2-yl)methyl]triazol-4-yl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 142522212 |
| Molecular Formula | C25H31N5O2S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | N-[2-[1-[(3,4-dimethoxyphenyl)-(6-ethyl-1,3-benzothiazol-2-yl)methyl]triazol-4-yl]ethyl]propan-1-amine |
| SMILES | CCCNCCc1cn(C(c2ccc(OC)c(OC)c2)c2nc3ccc(CC)cc3s2)nn1 |
| InChI | InChI=1S/C25H31N5O2S/c1-5-12-26-13-11-19-16-30(29-28-19)24(18-8-10-21(31-3)22(15-18)32-4)25-27-20-9-7-17(6-2)14-23(20)33-25/h7-10,14-16,24,26H,5-6,11-13H2,1-4H3 |
| InChIKey | INRABIZGWXQCDB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|