C22H25N5O2S — CID 142522217
4-[[4-[2-(dimethylamino)ethyl]triazol-1-yl]-(6-ethyl-1,3-benzothiazol-2-yl)methyl]benzene-1,2-diol (PubChem CID 142522217) has the molecular formula C22H25N5O2S and a molecular weight of 423.54 g/mol. Its IUPAC name is 4-[[4-[2-(dimethylamino)ethyl]triazol-1-yl]-(6-ethyl-1,3-benzothiazol-2-yl)methyl]benzene-1,2-diol.
| Compound Name | 4-[[4-[2-(dimethylamino)ethyl]triazol-1-yl]-(6-ethyl-1,3-benzothiazol-2-yl)methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 142522217 |
| Molecular Formula | C22H25N5O2S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 4-[[4-[2-(dimethylamino)ethyl]triazol-1-yl]-(6-ethyl-1,3-benzothiazol-2-yl)methyl]benzene-1,2-diol |
| SMILES | CCc1ccc2nc(C(c3ccc(O)c(O)c3)n3cc(CCN(C)C)nn3)sc2c1 |
| InChI | InChI=1S/C22H25N5O2S/c1-4-14-5-7-17-20(11-14)30-22(23-17)21(15-6-8-18(28)19(29)12-15)27-13-16(24-25-27)9-10-26(2)3/h5-8,11-13,21,28-29H,4,9-10H2,1-3H3 |
| InChIKey | YNAVOVQGVNIQFT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|