About [5-hydroxy-3,4-bis(hydroxymethyl)-6-methyl-2-pyridinyl]methanesulfonic acid
[5-hydroxy-3,4-bis(hydroxymethyl)-6-methyl-2-pyridinyl]methanesulfonic acid (PubChem CID 142522270) has the molecular formula C9H13NO6S
and a molecular weight of 263.27 g/mol. Its IUPAC name is [5-hydroxy-3,4-bis(hydroxymethyl)-6-methyl-2-pyridinyl]methanesulfonic acid.
Molecular Properties
| Compound Name | [5-hydroxy-3,4-bis(hydroxymethyl)-6-methyl-2-pyridinyl]methanesulfonic acid |
| PubChem CID | 142522270 |
| Molecular Formula | C9H13NO6S |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | [5-hydroxy-3,4-bis(hydroxymethyl)-6-methyl-2-pyridinyl]methanesulfonic acid |
| SMILES | Cc1nc(CS(=O)(=O)O)c(CO)c(CO)c1O |
| InChI | InChI=1S/C9H13NO6S/c1-5-9(13)7(3-12)6(2-11)8(10-5)4-17(14,15)16/h11-13H,2-4H2,1H3,(H,14,15,16) |
| InChIKey | ZLSUBYPSRHXUFH-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze [5-hydroxy-3,4-bis(hydroxymethyl)-6-methyl-2-pyridinyl]methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-hydroxy-3,4-bis(hydroxymethyl)-6-methyl-2-pyridinyl]methanesulfonic acid?
The IUPAC name of [5-hydroxy-3,4-bis(hydroxymethyl)-6-methyl-2-pyridinyl]methanesulfonic acid (CID 142522270) is [5-hydroxy-3,4-bis(hydroxymethyl)-6-methyl-2-pyridinyl]methanesulfonic acid.
What is the SMILES notation for [5-hydroxy-3,4-bis(hydroxymethyl)-6-methyl-2-pyridinyl]methanesulfonic acid?
The canonical SMILES for [5-hydroxy-3,4-bis(hydroxymethyl)-6-methyl-2-pyridinyl]methanesulfonic acid is Cc1nc(CS(=O)(=O)O)c(CO)c(CO)c1O.
What is the InChIKey of [5-hydroxy-3,4-bis(hydroxymethyl)-6-methyl-2-pyridinyl]methanesulfonic acid?
The InChIKey is ZLSUBYPSRHXUFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO6S/c1-5-9(13)7(3-12)6(2-11)8(10-5)4-17(14,15)16/h11-13H,2-4H2,1H3,(H,14,15,16).
What are the key properties of [5-hydroxy-3,4-bis(hydroxymethyl)-6-methyl-2-pyridinyl]methanesulfonic acid?
[5-hydroxy-3,4-bis(hydroxymethyl)-6-methyl-2-pyridinyl]methanesulfonic acid has a molecular weight of 263.27 g/mol, XLogP of -0.53, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-hydroxy-3,4-bis(hydroxymethyl)-6-methyl-2-pyridinyl]methanesulfonic acid is sourced from PubChem (CID 142522270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).